C24H27NOS — CID 164958776
2,6,6-trimethylspiro[5,7-dihydro-4H-benzo[f][1,3]benzothiazole-9,5'-6,7,8,9-tetrahydrobenzo[7]annulene]-8-one (PubChem CID 164958776) has the molecular formula C24H27NOS and a molecular weight of 377.55 g/mol. Its IUPAC name is 2,6,6-trimethylspiro[5,7-dihydro-4H-benzo[f][1,3]benzothiazole-9,5'-6,7,8,9-tetrahydrobenzo[7]annulene]-8-one.
| Compound Name | 2,6,6-trimethylspiro[5,7-dihydro-4H-benzo[f][1,3]benzothiazole-9,5'-6,7,8,9-tetrahydrobenzo[7]annulene]-8-one |
|---|---|
| PubChem CID | 164958776 |
| Molecular Formula | C24H27NOS |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2,6,6-trimethylspiro[5,7-dihydro-4H-benzo[f][1,3]benzothiazole-9,5'-6,7,8,9-tetrahydrobenzo[7]annulene]-8-one |
| SMILES | Cc1nc2c(s1)C1(CCCCc3ccccc31)C1=C(C2)CC(C)(C)CC1=O |
| InChI | InChI=1S/C24H27NOS/c1-15-25-19-12-17-13-23(2,3)14-20(26)21(17)24(22(19)27-15)11-7-6-9-16-8-4-5-10-18(16)24/h4-5,8,10H,6-7,9,11-14H2,1-3H3 |
| InChIKey | XFJDJRCDTWDZOU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |