About (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate
(1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate (PubChem CID 164960055) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate.
Molecular Properties
| Compound Name | (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate |
| PubChem CID | 164960055 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate |
| SMILES | C=Cc1cc(O)cc(C(=O)OC2(CC)CCCC2)c1 |
| InChI | InChI=1S/C16H20O3/c1-3-12-9-13(11-14(17)10-12)15(18)19-16(4-2)7-5-6-8-16/h3,9-11,17H,1,4-8H2,2H3 |
| InChIKey | SYYVAXZHAUSWPM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate?
The IUPAC name of (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate (CID 164960055) is (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate.
What is the SMILES notation for (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate?
The canonical SMILES for (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate is C=Cc1cc(O)cc(C(=O)OC2(CC)CCCC2)c1.
What is the InChIKey of (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate?
The InChIKey is SYYVAXZHAUSWPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O3/c1-3-12-9-13(11-14(17)10-12)15(18)19-16(4-2)7-5-6-8-16/h3,9-11,17H,1,4-8H2,2H3.
What are the key properties of (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate?
(1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate has a molecular weight of 260.33 g/mol, XLogP of 3.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethylcyclopentyl) 3-ethenyl-5-hydroxybenzoate is sourced from PubChem (CID 164960055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).