C25H24BrN5O2 — CID 164960356
(2R,3S,4R,5S,7R)-7-(2-amino-3-bromoquinolin-7-yl)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)spiro[4.4]non-8-ene-3,4-diol (PubChem CID 164960356) has the molecular formula C25H24BrN5O2 and a molecular weight of 506.40 g/mol. Its IUPAC name is (2R,3S,4R,5S,7R)-7-(2-amino-3-bromoquinolin-7-yl)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)spiro[4.4]non-8-ene-3,4-diol.
| Compound Name | (2R,3S,4R,5S,7R)-7-(2-amino-3-bromoquinolin-7-yl)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)spiro[4.4]non-8-ene-3,4-diol |
|---|---|
| PubChem CID | 164960356 |
| Molecular Formula | C25H24BrN5O2 |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | (2R,3S,4R,5S,7R)-7-(2-amino-3-bromoquinolin-7-yl)-2-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)spiro[4.4]non-8-ene-3,4-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1C[C@@]2(C=C[C@H](c3ccc4cc(Br)c(N)nc4c3)C2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H24BrN5O2/c1-13-17-5-7-31(24(17)29-12-28-13)20-11-25(22(33)21(20)32)6-4-16(10-25)14-2-3-15-8-18(26)23(27)30-19(15)9-14/h2-9,12,16,20-22,32-33H,10-11H2,1H3,(H2,27,30)/t16-,20+,21-,22-,25-/m0/s1 |
| InChIKey | UJQFWAJFJDRVBU-TUBNONHHSA-N |
| XLogP | 4.03 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|