C19H25AuN3P2S+ — CID 164960577
gold(1+);methyl-phenyl-phenyl-sulfanylidene-λ5-phosphane;1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane (PubChem CID 164960577) has the molecular formula C19H25AuN3P2S+ and a molecular weight of 586.41 g/mol. Its IUPAC name is gold(1+);methyl-phenyl-phenyl-sulfanylidene-λ5-phosphane;1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane.
| Compound Name | gold(1+);methyl-phenyl-phenyl-sulfanylidene-λ5-phosphane;1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 164960577 |
| Molecular Formula | C19H25AuN3P2S+ |
| Molecular Weight | 586.41 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | gold(1+);methyl-phenyl-phenyl-sulfanylidene-λ5-phosphane;1,3,5-triaza-7-phosphoniatricyclo[3.3.1.13,7]decane |
| SMILES | C1N2CN3CN1C[PH+](C2)C3.CP(=S)(c1[c-]cccc1)c1ccccc1.[Au+] |
| InChI | InChI=1S/C13H12PS.C6H12N3P.Au/c1-14(15,12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-7-2-9-3-8(1)5-10(4-7)6-9;/h2-10H,1H3;1-6H2;/q-1;;+1/p+1 |
| InChIKey | HCYSQGYYBZHVJS-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|