C7H7F9N2O7S3 — CID 164960725
3,3,3-trifluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonylpropanamide (PubChem CID 164960725) has the molecular formula C7H7F9N2O7S3 and a molecular weight of 498.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonylpropanamide.
| Compound Name | 3,3,3-trifluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 164960725 |
| Molecular Formula | C7H7F9N2O7S3 |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 497.93 |
| IUPAC Name | 3,3,3-trifluoro-N-[1,1,2,2,3,3-hexafluoro-3-(methylsulfonylsulfamoyl)propyl]sulfonylpropanamide |
| SMILES | CS(=O)(=O)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C7H7F9N2O7S3/c1-26(20,21)18-28(24,25)7(15,16)5(11,12)6(13,14)27(22,23)17-3(19)2-4(8,9)10/h18H,2H2,1H3,(H,17,19) |
| InChIKey | JUUQODMEQFGBER-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|