About 2-bromo-6-chloroaniline;2-chloro-6-methylaniline
2-bromo-6-chloroaniline;2-chloro-6-methylaniline (PubChem CID 164960891) has the molecular formula C13H13BrCl2N2
and a molecular weight of 348.07 g/mol. Its IUPAC name is 2-bromo-6-chloroaniline;2-chloro-6-methylaniline.
Molecular Properties
| Compound Name | 2-bromo-6-chloroaniline;2-chloro-6-methylaniline |
| PubChem CID | 164960891 |
| Molecular Formula | C13H13BrCl2N2 |
| Molecular Weight | 348.07 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2-bromo-6-chloroaniline;2-chloro-6-methylaniline |
| SMILES | Cc1cccc(Cl)c1N.Nc1c(Cl)cccc1Br |
| InChI | InChI=1S/C7H8ClN.C6H5BrClN/c1-5-3-2-4-6(8)7(5)9;7-4-2-1-3-5(8)6(4)9/h2-4H,9H2,1H3;1-3H,9H2 |
| InChIKey | BVADVNLCTNZSQZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.07 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-chloroaniline;2-chloro-6-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-chloroaniline;2-chloro-6-methylaniline?
The IUPAC name of 2-bromo-6-chloroaniline;2-chloro-6-methylaniline (CID 164960891) is 2-bromo-6-chloroaniline;2-chloro-6-methylaniline.
What is the SMILES notation for 2-bromo-6-chloroaniline;2-chloro-6-methylaniline?
The canonical SMILES for 2-bromo-6-chloroaniline;2-chloro-6-methylaniline is Cc1cccc(Cl)c1N.Nc1c(Cl)cccc1Br.
What is the InChIKey of 2-bromo-6-chloroaniline;2-chloro-6-methylaniline?
The InChIKey is BVADVNLCTNZSQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN.C6H5BrClN/c1-5-3-2-4-6(8)7(5)9;7-4-2-1-3-5(8)6(4)9/h2-4H,9H2,1H3;1-3H,9H2.
What are the key properties of 2-bromo-6-chloroaniline;2-chloro-6-methylaniline?
2-bromo-6-chloroaniline;2-chloro-6-methylaniline has a molecular weight of 348.07 g/mol, XLogP of 4.92, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-chloroaniline;2-chloro-6-methylaniline is sourced from PubChem (CID 164960891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).