C36H39B2BrN4O7 — CID 164961185
CID 164961185 (PubChem CID 164961185) has the molecular formula C36H39B2BrN4O7 and a molecular weight of 741.26 g/mol.
| Compound Name | CID 164961185 |
|---|---|
| PubChem CID | 164961185 |
| Molecular Formula | C36H39B2BrN4O7 |
| Molecular Weight | 741.26 g/mol |
| Exact Mass | 740.22 |
| IUPAC Name | — |
| SMILES | O=C[B]N[C@H](C(=O)O)[C@@H]1CCCc2ccc(-c3ccnc(N4C[C@H]5C[C@@H]4CO5)c3)cc21.O=C[B]N[C@H](C(=O)O)[C@@H]1CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C23H25BN3O4.C13H14BBrNO3/c28-13-24-26-22(23(29)30)19-3-1-2-14-4-5-15(8-20(14)19)16-6-7-25-21(9-16)27-11-18-10-17(27)12-31-18;15-9-5-4-8-2-1-3-10(11(8)6-9)12(13(18)19)16-14-7-17/h4-9,13,17-19,22,26H,1-3,10-12H2,(H,29,30);4-7,10,12,16H,1-3H2,(H,18,19)/t17-,18-,19-,22+;10-,12+/m11/s1 |
| InChIKey | VQMNMERLCHGBGP-IBYLYYGNSA-N |
| XLogP | 3.72 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|