C32H42BCl3N8O4 — CID 164962043
4-[4-chloro-6-(2-methylpyrazol-3-yl)-2-pyridinyl]morpholine;4-(4,6-dichloro-2-pyridinyl)morpholine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 164962043) has the molecular formula C32H42BCl3N8O4 and a molecular weight of 719.91 g/mol. Its IUPAC name is 4-[4-chloro-6-(2-methylpyrazol-3-yl)-2-pyridinyl]morpholine;4-(4,6-dichloro-2-pyridinyl)morpholine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 4-[4-chloro-6-(2-methylpyrazol-3-yl)-2-pyridinyl]morpholine;4-(4,6-dichloro-2-pyridinyl)morpholine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 164962043 |
| Molecular Formula | C32H42BCl3N8O4 |
| Molecular Weight | 719.91 g/mol |
| Exact Mass | 718.25 |
| IUPAC Name | 4-[4-chloro-6-(2-methylpyrazol-3-yl)-2-pyridinyl]morpholine;4-(4,6-dichloro-2-pyridinyl)morpholine;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Clc1cc(Cl)nc(N2CCOCC2)c1.Cn1nccc1-c1cc(Cl)cc(N2CCOCC2)n1.Cn1nccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H15ClN4O.C10H17BN2O2.C9H10Cl2N2O/c1-17-12(2-3-15-17)11-8-10(14)9-13(16-11)18-4-6-19-7-5-18;1-9(2)10(3,4)15-11(14-9)8-6-7-12-13(8)5;10-7-5-8(11)12-9(6-7)13-1-3-14-4-2-13/h2-3,8-9H,4-7H2,1H3;6-7H,1-5H3;5-6H,1-4H2 |
| InChIKey | BYVZFZLRWCYBRY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 104.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.91 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|