C30H38Cl2N2O2 — CID 164962256
(2R,8aS)-2-amino-7-[(4S)-1-(3,4-dichlorophenyl)-6-methyl-3-oxoheptan-4-yl]-5-(2-phenylethyl)-2,3,5,6,7,8a-hexahydro-1H-indolizin-8-one (PubChem CID 164962256) has the molecular formula C30H38Cl2N2O2 and a molecular weight of 529.55 g/mol. Its IUPAC name is (2R,8aS)-2-amino-7-[(4S)-1-(3,4-dichlorophenyl)-6-methyl-3-oxoheptan-4-yl]-5-(2-phenylethyl)-2,3,5,6,7,8a-hexahydro-1H-indolizin-8-one.
| Compound Name | (2R,8aS)-2-amino-7-[(4S)-1-(3,4-dichlorophenyl)-6-methyl-3-oxoheptan-4-yl]-5-(2-phenylethyl)-2,3,5,6,7,8a-hexahydro-1H-indolizin-8-one |
|---|---|
| PubChem CID | 164962256 |
| Molecular Formula | C30H38Cl2N2O2 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | (2R,8aS)-2-amino-7-[(4S)-1-(3,4-dichlorophenyl)-6-methyl-3-oxoheptan-4-yl]-5-(2-phenylethyl)-2,3,5,6,7,8a-hexahydro-1H-indolizin-8-one |
| SMILES | CC(C)CC(C(=O)CCc1ccc(Cl)c(Cl)c1)C1CC(CCc2ccccc2)N2C[C@H](N)C[C@H]2C1=O |
| InChI | InChI=1S/C30H38Cl2N2O2/c1-19(2)14-24(29(35)13-10-21-9-12-26(31)27(32)15-21)25-17-23(11-8-20-6-4-3-5-7-20)34-18-22(33)16-28(34)30(25)36/h3-7,9,12,15,19,22-25,28H,8,10-11,13-14,16-18,33H2,1-2H3/t22-,23?,24?,25?,28+/m1/s1 |
| InChIKey | OAHVXABWZBSJQR-XUABNWRRSA-N |
| XLogP | 6.15 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |