C20H28IKN3O4P — CID 164963645
potassium [5-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-7-methyl-4-oxooctanoyl]-iodophosphanide (PubChem CID 164963645) has the molecular formula C20H28IKN3O4P and a molecular weight of 571.44 g/mol. Its IUPAC name is potassium [5-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-7-methyl-4-oxooctanoyl]-iodophosphanide.
| Compound Name | potassium [5-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-7-methyl-4-oxooctanoyl]-iodophosphanide |
|---|---|
| PubChem CID | 164963645 |
| Molecular Formula | C20H28IKN3O4P |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | potassium [5-[[2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-7-methyl-4-oxooctanoyl]-iodophosphanide |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)CN)C(=O)CCC(=O)[P-]I.[K+] |
| InChI | InChI=1S/C20H28IN3O4P.K/c1-13(2)10-15(17(25)8-9-19(27)29-21)24-20(28)16(23-18(26)12-22)11-14-6-4-3-5-7-14;/h3-7,13,15-16H,8-12,22H2,1-2H3,(H,23,26)(H,24,28);/q-1;+1 |
| InChIKey | CEDHMMXXFLGXQL-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|