C17H16ClNO4 — CID 164963811
methyl 4-[3-(5-chloro-2-methoxyphenyl)-2-oxopropyl]pyridine-2-carboxylate (PubChem CID 164963811) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is methyl 4-[3-(5-chloro-2-methoxyphenyl)-2-oxopropyl]pyridine-2-carboxylate.
| Compound Name | methyl 4-[3-(5-chloro-2-methoxyphenyl)-2-oxopropyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 164963811 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl 4-[3-(5-chloro-2-methoxyphenyl)-2-oxopropyl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(CC(=O)Cc2cc(Cl)ccc2OC)ccn1 |
| InChI | InChI=1S/C17H16ClNO4/c1-22-16-4-3-13(18)9-12(16)10-14(20)7-11-5-6-19-15(8-11)17(21)23-2/h3-6,8-9H,7,10H2,1-2H3 |
| InChIKey | CETXIMOUBVZDPA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |