C35H56F2N8O2 — CID 164965854
23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,26-difluoro-18-propan-2-yl-8,9,10,20,22,27-hexazahexacyclo[18.6.2.18,11.02,7.014,19.024,28]nonacos-11(29)-en-21-one (PubChem CID 164965854) has the molecular formula C35H56F2N8O2 and a molecular weight of 658.88 g/mol. Its IUPAC name is 23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,26-difluoro-18-propan-2-yl-8,9,10,20,22,27-hexazahexacyclo[18.6.2.18,11.02,7.014,19.024,28]nonacos-11(29)-en-21-one.
| Compound Name | 23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,26-difluoro-18-propan-2-yl-8,9,10,20,22,27-hexazahexacyclo[18.6.2.18,11.02,7.014,19.024,28]nonacos-11(29)-en-21-one |
|---|---|
| PubChem CID | 164965854 |
| Molecular Formula | C35H56F2N8O2 |
| Molecular Weight | 658.88 g/mol |
| Exact Mass | 658.45 |
| IUPAC Name | 23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,26-difluoro-18-propan-2-yl-8,9,10,20,22,27-hexazahexacyclo[18.6.2.18,11.02,7.014,19.024,28]nonacos-11(29)-en-21-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2N2C=C(CCC4CCCC(C(C)C)C43)NN2)C[C@H]1C |
| InChI | InChI=1S/C35H56F2N8O2/c1-6-29(46)42-16-21(5)43(17-20(42)4)33-25-15-27(37)31-30-26(36)11-8-12-28(30)44-18-23(40-41-44)14-13-22-9-7-10-24(19(2)3)32(22)45(34(25)38-31)35(47)39-33/h6,18-22,24-28,30-34,38,40-41H,1,7-17H2,2-5H3,(H,39,47)/t20-,21+,22?,24?,25?,26?,27?,28?,30?,31?,32?,33?,34?/m1/s1 |
| InChIKey | UCSQZOXMHCCRED-UBIXDQJYSA-N |
| XLogP | 3.99 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.88 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|