C36H58F2N8O2 — CID 164965855
24-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,27-difluoro-19-propan-2-yl-8,9,10,21,23,28-hexazahexacyclo[19.6.2.18,11.02,7.015,20.025,29]triacont-11(30)-en-22-one (PubChem CID 164965855) has the molecular formula C36H58F2N8O2 and a molecular weight of 672.91 g/mol. Its IUPAC name is 24-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,27-difluoro-19-propan-2-yl-8,9,10,21,23,28-hexazahexacyclo[19.6.2.18,11.02,7.015,20.025,29]triacont-11(30)-en-22-one.
| Compound Name | 24-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,27-difluoro-19-propan-2-yl-8,9,10,21,23,28-hexazahexacyclo[19.6.2.18,11.02,7.015,20.025,29]triacont-11(30)-en-22-one |
|---|---|
| PubChem CID | 164965855 |
| Molecular Formula | C36H58F2N8O2 |
| Molecular Weight | 672.91 g/mol |
| Exact Mass | 672.47 |
| IUPAC Name | 24-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-3,27-difluoro-19-propan-2-yl-8,9,10,21,23,28-hexazahexacyclo[19.6.2.18,11.02,7.015,20.025,29]triacont-11(30)-en-22-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2N2C=C(CCCC4CCCC(C(C)C)C43)NN2)C[C@H]1C |
| InChI | InChI=1S/C36H58F2N8O2/c1-6-30(47)43-17-22(5)44(18-21(43)4)34-26-16-28(38)32-31-27(37)14-9-15-29(31)45-19-24(41-42-45)12-7-10-23-11-8-13-25(20(2)3)33(23)46(35(26)39-32)36(48)40-34/h6,19-23,25-29,31-35,39,41-42H,1,7-18H2,2-5H3,(H,40,48)/t21-,22+,23?,25?,26?,27?,28?,29?,31?,32?,33?,34?,35?/m1/s1 |
| InChIKey | MVDJYJMHLMPWTQ-KZDVTGACSA-N |
| XLogP | 4.39 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.91 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|