C17H14N4O — CID 164966051
1-(4-isocyanophenyl)-3-(2-methyl-3H-indol-6-yl)urea (PubChem CID 164966051) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-(4-isocyanophenyl)-3-(2-methyl-3H-indol-6-yl)urea.
| Compound Name | 1-(4-isocyanophenyl)-3-(2-methyl-3H-indol-6-yl)urea |
|---|---|
| PubChem CID | 164966051 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-(4-isocyanophenyl)-3-(2-methyl-3H-indol-6-yl)urea |
| SMILES | [C-]#[N+]c1ccc(NC(=O)Nc2ccc3c(c2)N=C(C)C3)cc1 |
| InChI | InChI=1S/C17H14N4O/c1-11-9-12-3-4-15(10-16(12)19-11)21-17(22)20-14-7-5-13(18-2)6-8-14/h3-8,10H,9H2,1H3,(H2,20,21,22) |
| InChIKey | WYRQZXZVIOOWFU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|