C37H26F6N10O7 — CID 164968160
3-azido-5-(trifluoromethyl)benzoic acid;3-[4-[4-butanoyl-6-[1-[3-carboxy-5-(trifluoromethyl)phenyl]triazol-4-yl]-2-pyridinyl]triazol-1-yl]-5-methylbenzoic acid (PubChem CID 164968160) has the molecular formula C37H26F6N10O7 and a molecular weight of 836.67 g/mol. Its IUPAC name is 3-azido-5-(trifluoromethyl)benzoic acid;3-[4-[4-butanoyl-6-[1-[3-carboxy-5-(trifluoromethyl)phenyl]triazol-4-yl]-2-pyridinyl]triazol-1-yl]-5-methylbenzoic acid.
| Compound Name | 3-azido-5-(trifluoromethyl)benzoic acid;3-[4-[4-butanoyl-6-[1-[3-carboxy-5-(trifluoromethyl)phenyl]triazol-4-yl]-2-pyridinyl]triazol-1-yl]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 164968160 |
| Molecular Formula | C37H26F6N10O7 |
| Molecular Weight | 836.67 g/mol |
| Exact Mass | 836.19 |
| IUPAC Name | 3-azido-5-(trifluoromethyl)benzoic acid;3-[4-[4-butanoyl-6-[1-[3-carboxy-5-(trifluoromethyl)phenyl]triazol-4-yl]-2-pyridinyl]triazol-1-yl]-5-methylbenzoic acid |
| SMILES | CCCC(=O)c1cc(-c2cn(-c3cc(C)cc(C(=O)O)c3)nn2)nc(-c2cn(-c3cc(C(=O)O)cc(C(F)(F)F)c3)nn2)c1.[N-]=[N+]=Nc1cc(C(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H22F3N7O5.C8H4F3N3O2/c1-3-4-26(40)16-10-22(24-13-38(36-34-24)20-6-15(2)5-17(8-20)27(41)42)33-23(11-16)25-14-39(37-35-25)21-9-18(28(43)44)7-19(12-21)29(30,31)32;9-8(10,11)5-1-4(7(15)16)2-6(3-5)13-14-12/h5-14H,3-4H2,1-2H3,(H,41,42)(H,43,44);1-3H,(H,15,16) |
| InChIKey | CTGSESSIXOYADM-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 252.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.67 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|