C36H62F2N8O2 — CID 164968212
11-(2-aminoethyl)-23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-17,20-difluoro-3-propan-2-yl-1,4,11,24,27-pentazapentacyclo[17.6.2.02,7.013,18.022,26]heptacosan-25-one (PubChem CID 164968212) has the molecular formula C36H62F2N8O2 and a molecular weight of 676.94 g/mol. Its IUPAC name is 11-(2-aminoethyl)-23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-17,20-difluoro-3-propan-2-yl-1,4,11,24,27-pentazapentacyclo[17.6.2.02,7.013,18.022,26]heptacosan-25-one.
| Compound Name | 11-(2-aminoethyl)-23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-17,20-difluoro-3-propan-2-yl-1,4,11,24,27-pentazapentacyclo[17.6.2.02,7.013,18.022,26]heptacosan-25-one |
|---|---|
| PubChem CID | 164968212 |
| Molecular Formula | C36H62F2N8O2 |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 676.50 |
| IUPAC Name | 11-(2-aminoethyl)-23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-17,20-difluoro-3-propan-2-yl-1,4,11,24,27-pentazapentacyclo[17.6.2.02,7.013,18.022,26]heptacosan-25-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2CN(CCN)CCCC2CCNC(C(C)C)C23)C[C@H]1C |
| InChI | InChI=1S/C36H62F2N8O2/c1-6-29(47)44-18-23(5)45(19-22(44)4)34-26-17-28(38)32-30-25(9-7-11-27(30)37)20-43(16-13-39)15-8-10-24-12-14-40-31(21(2)3)33(24)46(35(26)41-32)36(48)42-34/h6,21-28,30-35,40-41H,1,7-20,39H2,2-5H3,(H,42,48)/t22-,23+,24?,25?,26?,27?,28?,30?,31?,32?,33?,34?,35?/m1/s1 |
| InChIKey | SQLGNPHHZBWJQJ-UYVHFCKWSA-N |
| XLogP | 2.90 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|