C22H31F10N3O6S2 — CID 164969041
1,3-bis[3-(3-hydroxypropylsulfanyl)propyl]-5-[2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3-hexafluorobutoxy)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 164969041) has the molecular formula C22H31F10N3O6S2 and a molecular weight of 687.62 g/mol. Its IUPAC name is 1,3-bis[3-(3-hydroxypropylsulfanyl)propyl]-5-[2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3-hexafluorobutoxy)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis[3-(3-hydroxypropylsulfanyl)propyl]-5-[2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3-hexafluorobutoxy)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 164969041 |
| Molecular Formula | C22H31F10N3O6S2 |
| Molecular Weight | 687.62 g/mol |
| Exact Mass | 687.15 |
| IUPAC Name | 1,3-bis[3-(3-hydroxypropylsulfanyl)propyl]-5-[2,2,3,3-tetrafluoro-3-(1,1,2,2,3,3-hexafluorobutoxy)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)Cn1c(=O)n(CCCSCCCO)c(=O)n(CCCSCCCO)c1=O |
| InChI | InChI=1S/C22H31F10N3O6S2/c1-18(23,24)20(27,28)22(31,32)41-21(29,30)19(25,26)14-35-16(39)33(6-2-10-42-12-4-8-36)15(38)34(17(35)40)7-3-11-43-13-5-9-37/h36-37H,2-14H2,1H3 |
| InChIKey | NLMMJMDJFUIIKE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|