About 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide
4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide (PubChem CID 164969463) has the molecular formula C12H16ClIN4O
and a molecular weight of 394.64 g/mol. Its IUPAC name is 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide.
Molecular Properties
| Compound Name | 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide |
| PubChem CID | 164969463 |
| Molecular Formula | C12H16ClIN4O |
| Molecular Weight | 394.64 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide |
| SMILES | Cc1c[nH]c(=O)cc1N.Cc1cnc(Cl)cc1N.I |
| InChI | InChI=1S/C6H7ClN2.C6H8N2O.HI/c1-4-3-9-6(7)2-5(4)8;1-4-3-8-6(9)2-5(4)7;/h2-3H,1H3,(H2,8,9);2-3H,1H3,(H3,7,8,9);1H |
| InChIKey | SQZZZQUAYVWWLV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide?
The IUPAC name of 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide (CID 164969463) is 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide.
What is the SMILES notation for 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide?
The canonical SMILES for 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide is Cc1c[nH]c(=O)cc1N.Cc1cnc(Cl)cc1N.I.
What is the InChIKey of 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide?
The InChIKey is SQZZZQUAYVWWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2.C6H8N2O.HI/c1-4-3-9-6(7)2-5(4)8;1-4-3-8-6(9)2-5(4)7;/h2-3H,1H3,(H2,8,9);2-3H,1H3,(H3,7,8,9);1H.
What are the key properties of 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide?
4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide has a molecular weight of 394.64 g/mol, XLogP of 2.51, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-methyl-1H-pyridin-2-one;2-chloro-5-methylpyridin-4-amine;hydroiodide is sourced from PubChem (CID 164969463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).