C27H19N5O2S3 — CID 164969579
3-[[4-(15-methyl-8,11-dithia-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaen-12-yl)-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione (PubChem CID 164969579) has the molecular formula C27H19N5O2S3 and a molecular weight of 541.68 g/mol. Its IUPAC name is 3-[[4-(15-methyl-8,11-dithia-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaen-12-yl)-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione.
| Compound Name | 3-[[4-(15-methyl-8,11-dithia-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaen-12-yl)-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione |
|---|---|
| PubChem CID | 164969579 |
| Molecular Formula | C27H19N5O2S3 |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | 3-[[4-(15-methyl-8,11-dithia-15-azatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,10(14),12-hexaen-12-yl)-[1,2,5]thiadiazolo[3,4-c]pyridin-7-yl]imino]-3a,4,5,6,7,7a-hexahydroindene-1,2-dione |
| SMILES | Cn1c2cc(-c3ncc(/N=C4\C(=O)C(=O)C5CCCCC45)c4nsnc34)sc2c2sc3ccccc3c21 |
| InChI | InChI=1S/C27H19N5O2S3/c1-32-16-10-18(36-26(16)27-23(32)14-8-4-5-9-17(14)35-27)21-22-20(30-37-31-22)15(11-28-21)29-19-12-6-2-3-7-13(12)24(33)25(19)34/h4-5,8-13H,2-3,6-7H2,1H3/b29-19- |
| InChIKey | AARNYOXTVCGWER-CEUNXORHSA-N |
| XLogP | 6.71 |
| TPSA | 90.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|