C10H13BO3 — CID 164970177
(4-acetyl-2,3-dimethylphenyl)boronic acid (PubChem CID 164970177) has the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. Its IUPAC name is (4-acetyl-2,3-dimethylphenyl)boronic acid.
| Compound Name | (4-acetyl-2,3-dimethylphenyl)boronic acid |
|---|---|
| PubChem CID | 164970177 |
| Molecular Formula | C10H13BO3 |
| Molecular Weight | 192.02 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (4-acetyl-2,3-dimethylphenyl)boronic acid |
| SMILES | CC(=O)c1ccc(B(O)O)c(C)c1C |
| InChI | InChI=1S/C10H13BO3/c1-6-7(2)10(11(13)14)5-4-9(6)8(3)12/h4-5,13-14H,1-3H3 |
| InChIKey | OWPQLQQTXMDTKC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.02 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|