C75H51N5 — CID 164970211
4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-N-(4-carbazol-9-ylphenyl)-2,6-diphenyl-N-(3-phenylphenyl)aniline (PubChem CID 164970211) has the molecular formula C75H51N5 and a molecular weight of 1022.27 g/mol. Its IUPAC name is 4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-N-(4-carbazol-9-ylphenyl)-2,6-diphenyl-N-(3-phenylphenyl)aniline.
| Compound Name | 4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-N-(4-carbazol-9-ylphenyl)-2,6-diphenyl-N-(3-phenylphenyl)aniline |
|---|---|
| PubChem CID | 164970211 |
| Molecular Formula | C75H51N5 |
| Molecular Weight | 1022.27 g/mol |
| Exact Mass | 1021.41 |
| IUPAC Name | 4-[4,6-bis(4-phenylphenyl)-1,3,5-triazin-2-yl]-N-(4-carbazol-9-ylphenyl)-2,6-diphenyl-N-(3-phenylphenyl)aniline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4cc(-c5ccccc5)c(N(c5ccc(-n6c7ccccc7c7ccccc76)cc5)c5cccc(-c6ccccc6)c5)c(-c5ccccc5)c4)n3)cc2)cc1 |
| InChI | InChI=1S/C75H51N5/c1-6-21-52(22-7-1)55-37-41-59(42-38-55)73-76-74(60-43-39-56(40-44-60)53-23-8-2-9-24-53)78-75(77-73)62-50-68(57-27-12-4-13-28-57)72(69(51-62)58-29-14-5-15-30-58)79(65-32-20-31-61(49-65)54-25-10-3-11-26-54)63-45-47-64(48-46-63)80-70-35-18-16-33-66(70)67-34-17-19-36-71(67)80/h1-51H |
| InChIKey | FHGHHGSUPDLRQT-UHFFFAOYSA-N |
| XLogP | 19.77 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.27 |
| LogP ≤ 5 | 19.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |