About N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine
N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine (PubChem CID 164971223) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine |
| PubChem CID | 164971223 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine |
| SMILES | C=C(CCCNC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H27N/c1-11(12(2,3)4)9-8-10-14-13(5,6)7/h14H,1,8-10H2,2-7H3 |
| InChIKey | DDNWEIFWHMLGJU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine?
The IUPAC name of N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine (CID 164971223) is N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine.
What is the SMILES notation for N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine?
The canonical SMILES for N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine is C=C(CCCNC(C)(C)C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine?
The InChIKey is DDNWEIFWHMLGJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-11(12(2,3)4)9-8-10-14-13(5,6)7/h14H,1,8-10H2,2-7H3.
What are the key properties of N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine?
N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine has a molecular weight of 197.37 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-5,5-dimethyl-4-methylidenehexan-1-amine is sourced from PubChem (CID 164971223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).