About 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene
5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene (PubChem CID 164971489) has the molecular formula C14H14S3
and a molecular weight of 278.47 g/mol. Its IUPAC name is 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene |
| PubChem CID | 164971489 |
| Molecular Formula | C14H14S3 |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene |
| SMILES | Cc1cc(-c2cc3sc(C)c(C)c3s2)sc1C |
| InChI | InChI=1S/C14H14S3/c1-7-5-11(15-9(7)3)12-6-13-14(17-12)8(2)10(4)16-13/h5-6H,1-4H3 |
| InChIKey | NBULSJNVJBQURY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene?
The IUPAC name of 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene (CID 164971489) is 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene.
What is the SMILES notation for 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene?
The canonical SMILES for 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene is Cc1cc(-c2cc3sc(C)c(C)c3s2)sc1C.
What is the InChIKey of 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene?
The InChIKey is NBULSJNVJBQURY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S3/c1-7-5-11(15-9(7)3)12-6-13-14(17-12)8(2)10(4)16-13/h5-6H,1-4H3.
What are the key properties of 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene?
5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene has a molecular weight of 278.47 g/mol, XLogP of 5.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,5-dimethylthiophen-2-yl)-2,3-dimethylthieno[3,2-b]thiophene is sourced from PubChem (CID 164971489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).