C18H28N2O — CID 164971686
N-[4-(2,2-dimethylpropyl)cyclohexyl]-2-pyridin-2-ylacetamide (PubChem CID 164971686) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is N-[4-(2,2-dimethylpropyl)cyclohexyl]-2-pyridin-2-ylacetamide.
| Compound Name | N-[4-(2,2-dimethylpropyl)cyclohexyl]-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 164971686 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-[4-(2,2-dimethylpropyl)cyclohexyl]-2-pyridin-2-ylacetamide |
| SMILES | CC(C)(C)CC1CCC(NC(=O)Cc2ccccn2)CC1 |
| InChI | InChI=1S/C18H28N2O/c1-18(2,3)13-14-7-9-15(10-8-14)20-17(21)12-16-6-4-5-11-19-16/h4-6,11,14-15H,7-10,12-13H2,1-3H3,(H,20,21) |
| InChIKey | UWUZLIIJKSAUGV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |