C18H22N2 — CID 164972447
1-benzyl-3-propan-2-ylbenzimidazol-1-ium;carbanide (PubChem CID 164972447) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-benzyl-3-propan-2-ylbenzimidazol-1-ium;carbanide.
| Compound Name | 1-benzyl-3-propan-2-ylbenzimidazol-1-ium;carbanide |
|---|---|
| PubChem CID | 164972447 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-benzyl-3-propan-2-ylbenzimidazol-1-ium;carbanide |
| SMILES | CC(C)n1c[n+](Cc2ccccc2)c2ccccc21.[CH3-] |
| InChI | InChI=1S/C17H19N2.CH3/c1-14(2)19-13-18(12-15-8-4-3-5-9-15)16-10-6-7-11-17(16)19;/h3-11,13-14H,12H2,1-2H3;1H3/q+1;-1 |
| InChIKey | DHXGNMAGFCLWLD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|