C34H40N2O5 — CID 164972526
4-amino-2,5-dimethylbenzoic acid;(4-methylphenyl)methanol;(4-methylphenyl)methyl 4-amino-2,5-dimethylbenzoate (PubChem CID 164972526) has the molecular formula C34H40N2O5 and a molecular weight of 556.70 g/mol. Its IUPAC name is 4-amino-2,5-dimethylbenzoic acid;(4-methylphenyl)methanol;(4-methylphenyl)methyl 4-amino-2,5-dimethylbenzoate.
| Compound Name | 4-amino-2,5-dimethylbenzoic acid;(4-methylphenyl)methanol;(4-methylphenyl)methyl 4-amino-2,5-dimethylbenzoate |
|---|---|
| PubChem CID | 164972526 |
| Molecular Formula | C34H40N2O5 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 4-amino-2,5-dimethylbenzoic acid;(4-methylphenyl)methanol;(4-methylphenyl)methyl 4-amino-2,5-dimethylbenzoate |
| SMILES | Cc1cc(C(=O)O)c(C)cc1N.Cc1ccc(CO)cc1.Cc1ccc(COC(=O)c2cc(C)c(N)cc2C)cc1 |
| InChI | InChI=1S/C17H19NO2.C9H11NO2.C8H10O/c1-11-4-6-14(7-5-11)10-20-17(19)15-8-13(3)16(18)9-12(15)2;1-5-4-8(10)6(2)3-7(5)9(11)12;1-7-2-4-8(6-9)5-3-7/h4-9H,10,18H2,1-3H3;3-4H,10H2,1-2H3,(H,11,12);2-5,9H,6H2,1H3 |
| InChIKey | DIBVHLRIOFGOOP-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|