C31H34N6O3S — CID 164973890
4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-8-(1-methylindazol-7-yl)spiro[10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraene-12,3'-oxetane]-2-one (PubChem CID 164973890) has the molecular formula C31H34N6O3S and a molecular weight of 570.72 g/mol. Its IUPAC name is 4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-8-(1-methylindazol-7-yl)spiro[10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraene-12,3'-oxetane]-2-one.
| Compound Name | 4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-8-(1-methylindazol-7-yl)spiro[10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraene-12,3'-oxetane]-2-one |
|---|---|
| PubChem CID | 164973890 |
| Molecular Formula | C31H34N6O3S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 4-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-7-methyl-8-(1-methylindazol-7-yl)spiro[10-thia-1,3-diazatricyclo[7.4.1.05,14]tetradeca-3,5(14),6,8-tetraene-12,3'-oxetane]-2-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(c2nc(=O)n3c4c(c(-c5cccc6cnn(C)c56)c(C)cc24)SCC2(COC2)C3)C[C@H]1C |
| InChI | InChI=1S/C31H34N6O3S/c1-6-24(38)35-12-20(4)36(13-19(35)3)29-23-10-18(2)25(22-9-7-8-21-11-32-34(5)26(21)22)28-27(23)37(30(39)33-29)14-31(17-41-28)15-40-16-31/h6-11,19-20H,1,12-17H2,2-5H3/t19-,20+/m1/s1 |
| InChIKey | IDNIIYFPYLITLM-UXHICEINSA-N |
| XLogP | 3.99 |
| TPSA | 85.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|