C23H15F8NO3S — CID 164974048
N-[(4-acetylphenyl)methyl]-2,3,4,5,6-pentafluoro-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 164974048) has the molecular formula C23H15F8NO3S and a molecular weight of 537.43 g/mol. Its IUPAC name is N-[(4-acetylphenyl)methyl]-2,3,4,5,6-pentafluoro-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[(4-acetylphenyl)methyl]-2,3,4,5,6-pentafluoro-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 164974048 |
| Molecular Formula | C23H15F8NO3S |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | N-[(4-acetylphenyl)methyl]-2,3,4,5,6-pentafluoro-N-[[4-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | CC(=O)c1ccc(CN(Cc2ccc(C(F)(F)F)cc2)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C23H15F8NO3S/c1-12(33)15-6-2-13(3-7-15)10-32(11-14-4-8-16(9-5-14)23(29,30)31)36(34,35)22-20(27)18(25)17(24)19(26)21(22)28/h2-9H,10-11H2,1H3 |
| InChIKey | UGOCIBRBXMZFIJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|