C26H24F5NO3S — CID 164974049
N-[(4-acetylphenyl)methyl]-N-[(4-tert-butylphenyl)methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide (PubChem CID 164974049) has the molecular formula C26H24F5NO3S and a molecular weight of 525.54 g/mol. Its IUPAC name is N-[(4-acetylphenyl)methyl]-N-[(4-tert-butylphenyl)methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide.
| Compound Name | N-[(4-acetylphenyl)methyl]-N-[(4-tert-butylphenyl)methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 164974049 |
| Molecular Formula | C26H24F5NO3S |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | N-[(4-acetylphenyl)methyl]-N-[(4-tert-butylphenyl)methyl]-2,3,4,5,6-pentafluorobenzenesulfonamide |
| SMILES | CC(=O)c1ccc(CN(Cc2ccc(C(C)(C)C)cc2)S(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C26H24F5NO3S/c1-15(33)18-9-5-16(6-10-18)13-32(14-17-7-11-19(12-8-17)26(2,3)4)36(34,35)25-23(30)21(28)20(27)22(29)24(25)31/h5-12H,13-14H2,1-4H3 |
| InChIKey | KQXXULASPSHLNO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|