C90H59BClN6O2S2 — CID 164975367
CID 164975367 (PubChem CID 164975367) has the molecular formula C90H59BClN6O2S2 and a molecular weight of 1366.90 g/mol.
| Compound Name | CID 164975367 |
|---|---|
| PubChem CID | 164975367 |
| Molecular Formula | C90H59BClN6O2S2 |
| Molecular Weight | 1366.90 g/mol |
| Exact Mass | 1365.39 |
| IUPAC Name | — |
| SMILES | Clc1nc(-c2ccc(-c3ccccc3)cc2)nc(-c2ccc(-c3ccccc3)cc2)n1.O[B]Oc1ccc(-c2ccc3sc4ccccc4c3c2)cc1.c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(-c5ccc6sc7ccccc7c6c5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C45H29N3S.C27H18ClN3.C18H12BO2S/c1-3-9-30(10-4-1)32-15-21-35(22-16-32)43-46-44(36-23-17-33(18-24-36)31-11-5-2-6-12-31)48-45(47-43)37-25-19-34(20-26-37)38-27-28-42-40(29-38)39-13-7-8-14-41(39)49-42;28-27-30-25(23-15-11-21(12-16-23)19-7-3-1-4-8-19)29-26(31-27)24-17-13-22(14-18-24)20-9-5-2-6-10-20;20-19-21-14-8-5-12(6-9-14)13-7-10-18-16(11-13)15-3-1-2-4-17(15)22-18/h1-29H;1-18H;1-11,20H |
| InChIKey | ZITHJJZJWFWNDC-UHFFFAOYSA-N |
| XLogP | 24.06 |
| TPSA | 106.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 102 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1366.90 |
| LogP ≤ 5 | 24.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|