C35H57F2N9O2 — CID 164976544
3,27-difluoro-14-methyl-24-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-19-propan-2-yl-8,9,10,14,21,23,28-heptazahexacyclo[19.6.2.18,11.02,7.015,20.025,29]triacont-11(30)-en-22-one (PubChem CID 164976544) has the molecular formula C35H57F2N9O2 and a molecular weight of 673.90 g/mol. Its IUPAC name is 3,27-difluoro-14-methyl-24-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-19-propan-2-yl-8,9,10,14,21,23,28-heptazahexacyclo[19.6.2.18,11.02,7.015,20.025,29]triacont-11(30)-en-22-one.
| Compound Name | 3,27-difluoro-14-methyl-24-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-19-propan-2-yl-8,9,10,14,21,23,28-heptazahexacyclo[19.6.2.18,11.02,7.015,20.025,29]triacont-11(30)-en-22-one |
|---|---|
| PubChem CID | 164976544 |
| Molecular Formula | C35H57F2N9O2 |
| Molecular Weight | 673.90 g/mol |
| Exact Mass | 673.46 |
| IUPAC Name | 3,27-difluoro-14-methyl-24-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]-19-propan-2-yl-8,9,10,14,21,23,28-heptazahexacyclo[19.6.2.18,11.02,7.015,20.025,29]triacont-11(30)-en-22-one |
| SMILES | C=CC(=O)N1CCN(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2N2C=C(CCN(C)C4CCCC(C(C)C)C43)NN2)[C@@H](C)C1 |
| InChI | InChI=1S/C35H57F2N9O2/c1-6-29(47)43-15-16-44(21(4)18-43)33-24-17-26(37)31-30-25(36)10-8-11-27(30)45-19-22(40-41-45)13-14-42(5)28-12-7-9-23(20(2)3)32(28)46(34(24)38-31)35(48)39-33/h6,19-21,23-28,30-34,38,40-41H,1,7-18H2,2-5H3,(H,39,48)/t21-,23?,24?,25?,26?,27?,28?,30?,31?,32?,33?,34?/m0/s1 |
| InChIKey | RRLOSOWFFOECKK-PJCIEFJFSA-N |
| XLogP | 2.90 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.90 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|