C16H27NO — CID 164977407
4-[3-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxypropyl]piperidine (PubChem CID 164977407) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-[3-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxypropyl]piperidine.
| Compound Name | 4-[3-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxypropyl]piperidine |
|---|---|
| PubChem CID | 164977407 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 4-[3-[(3S,4S)-3,4-dimethylcyclohexa-1,5-dien-1-yl]oxypropyl]piperidine |
| SMILES | C[C@@H]1C=C(OCCCC2CCNCC2)C=C[C@@H]1C |
| InChI | InChI=1S/C16H27NO/c1-13-5-6-16(12-14(13)2)18-11-3-4-15-7-9-17-10-8-15/h5-6,12-15,17H,3-4,7-11H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | FPWFSHDYYYTWHQ-UONOGXRCSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|