C17H16F3N5O2 — CID 164977495
5,5,5-trifluoro-1-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-yl]pentan-1-one (PubChem CID 164977495) has the molecular formula C17H16F3N5O2 and a molecular weight of 379.34 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-yl]pentan-1-one.
| Compound Name | 5,5,5-trifluoro-1-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 164977495 |
| Molecular Formula | C17H16F3N5O2 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 5,5,5-trifluoro-1-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-yl]pentan-1-one |
| SMILES | O=C(CCCC(F)(F)F)c1noc2c1CN(c1ncnc3[nH]ccc13)CC2 |
| InChI | InChI=1S/C17H16F3N5O2/c18-17(19,20)5-1-2-12(26)14-11-8-25(7-4-13(11)27-24-14)16-10-3-6-21-15(10)22-9-23-16/h3,6,9H,1-2,4-5,7-8H2,(H,21,22,23) |
| InChIKey | RAZYQYLHTLLGFT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |