C24H16N4S2 — CID 164978643
2-[[11-(2,2-dicyanoethenyl)-3,3,10,10-tetramethyl-7,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-4-yl]methylidene]propanedinitrile (PubChem CID 164978643) has the molecular formula C24H16N4S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[[11-(2,2-dicyanoethenyl)-3,3,10,10-tetramethyl-7,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-4-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[11-(2,2-dicyanoethenyl)-3,3,10,10-tetramethyl-7,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-4-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 164978643 |
| Molecular Formula | C24H16N4S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-[[11-(2,2-dicyanoethenyl)-3,3,10,10-tetramethyl-7,14-dithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaen-4-yl]methylidene]propanedinitrile |
| SMILES | CC1(C)C(C=C(C#N)C#N)=Cc2sc3c4c(sc3c21)C=C(C=C(C#N)C#N)C4(C)C |
| InChI | InChI=1S/C24H16N4S2/c1-23(2)15(5-13(9-25)10-26)7-17-19(23)21-22(29-17)20-18(30-21)8-16(24(20,3)4)6-14(11-27)12-28/h5-8H,1-4H3 |
| InChIKey | QYCGOQREQMPPMW-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|