C25H25NO5 — CID 164979266
2-[5-hydroxy-8,8-dimethyl-6-(3-methylbut-2-enyl)-4-oxopyrano[2,3-h]chromen-3-yl]-5-methyl-1H-pyridin-4-one (PubChem CID 164979266) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is 2-[5-hydroxy-8,8-dimethyl-6-(3-methylbut-2-enyl)-4-oxopyrano[2,3-h]chromen-3-yl]-5-methyl-1H-pyridin-4-one.
| Compound Name | 2-[5-hydroxy-8,8-dimethyl-6-(3-methylbut-2-enyl)-4-oxopyrano[2,3-h]chromen-3-yl]-5-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 164979266 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 2-[5-hydroxy-8,8-dimethyl-6-(3-methylbut-2-enyl)-4-oxopyrano[2,3-h]chromen-3-yl]-5-methyl-1H-pyridin-4-one |
| SMILES | CC(C)=CCc1c2c(c3occ(-c4cc(=O)c(C)c[nH]4)c(=O)c3c1O)C=CC(C)(C)O2 |
| InChI | InChI=1S/C25H25NO5/c1-13(2)6-7-15-21(28)20-22(29)17(18-10-19(27)14(3)11-26-18)12-30-24(20)16-8-9-25(4,5)31-23(15)16/h6,8-12,28H,7H2,1-5H3,(H,26,27) |
| InChIKey | KEUVNVNPIXXHBK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 92.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|