C14H20ClF2NO — CID 164980358
(R)-(4-amino-3,5-difluorophenyl)-[(1S)-3,3-dimethylcyclopentyl]methanol;hydrochloride (PubChem CID 164980358) has the molecular formula C14H20ClF2NO and a molecular weight of 291.77 g/mol. Its IUPAC name is (R)-(4-amino-3,5-difluorophenyl)-[(1S)-3,3-dimethylcyclopentyl]methanol;hydrochloride.
| Compound Name | (R)-(4-amino-3,5-difluorophenyl)-[(1S)-3,3-dimethylcyclopentyl]methanol;hydrochloride |
|---|---|
| PubChem CID | 164980358 |
| Molecular Formula | C14H20ClF2NO |
| Molecular Weight | 291.77 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (R)-(4-amino-3,5-difluorophenyl)-[(1S)-3,3-dimethylcyclopentyl]methanol;hydrochloride |
| SMILES | CC1(C)CC[C@H]([C@@H](O)c2cc(F)c(N)c(F)c2)C1.Cl |
| InChI | InChI=1S/C14H19F2NO.ClH/c1-14(2)4-3-8(7-14)13(18)9-5-10(15)12(17)11(16)6-9;/h5-6,8,13,18H,3-4,7,17H2,1-2H3;1H/t8-,13+;/m0./s1 |
| InChIKey | UOXVWGYVOCOQTN-CPBFHQHQSA-N |
| XLogP | 3.83 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.77 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|