C52H45FN6O3S — CID 164981125
5-ethyl-2-[3-methyl-4-(2-methylphenyl)phenoxy]pyridine;3-fluoro-4-(4-pyridin-4-ylphenoxy)aniline;6-[4-(1,3-thiazol-2-yl)phenoxy]pyridin-3-amine (PubChem CID 164981125) has the molecular formula C52H45FN6O3S and a molecular weight of 853.04 g/mol. Its IUPAC name is 5-ethyl-2-[3-methyl-4-(2-methylphenyl)phenoxy]pyridine;3-fluoro-4-(4-pyridin-4-ylphenoxy)aniline;6-[4-(1,3-thiazol-2-yl)phenoxy]pyridin-3-amine.
| Compound Name | 5-ethyl-2-[3-methyl-4-(2-methylphenyl)phenoxy]pyridine;3-fluoro-4-(4-pyridin-4-ylphenoxy)aniline;6-[4-(1,3-thiazol-2-yl)phenoxy]pyridin-3-amine |
|---|---|
| PubChem CID | 164981125 |
| Molecular Formula | C52H45FN6O3S |
| Molecular Weight | 853.04 g/mol |
| Exact Mass | 852.33 |
| IUPAC Name | 5-ethyl-2-[3-methyl-4-(2-methylphenyl)phenoxy]pyridine;3-fluoro-4-(4-pyridin-4-ylphenoxy)aniline;6-[4-(1,3-thiazol-2-yl)phenoxy]pyridin-3-amine |
| SMILES | CCc1ccc(Oc2ccc(-c3ccccc3C)c(C)c2)nc1.Nc1ccc(Oc2ccc(-c3ccncc3)cc2)c(F)c1.Nc1ccc(Oc2ccc(-c3nccs3)cc2)nc1 |
| InChI | InChI=1S/C21H21NO.C17H13FN2O.C14H11N3OS/c1-4-17-9-12-21(22-14-17)23-18-10-11-20(16(3)13-18)19-8-6-5-7-15(19)2;18-16-11-14(19)3-6-17(16)21-15-4-1-12(2-5-15)13-7-9-20-10-8-13;15-11-3-6-13(17-9-11)18-12-4-1-10(2-5-12)14-16-7-8-19-14/h5-14H,4H2,1-3H3;1-11H,19H2;1-9H,15H2 |
| InChIKey | FMPTVLHUZMCLSK-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 131.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.04 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_A(8)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|