About 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one
1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one (PubChem CID 164982464) has the molecular formula C11H21F2NO
and a molecular weight of 221.29 g/mol. Its IUPAC name is 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one.
Molecular Properties
| Compound Name | 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one |
| PubChem CID | 164982464 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one |
| SMILES | CC(C)CC(=O)CN(C)C(F)(F)C(C)C |
| InChI | InChI=1S/C11H21F2NO/c1-8(2)6-10(15)7-14(5)11(12,13)9(3)4/h8-9H,6-7H2,1-5H3 |
| InChIKey | ZHECKBDNATWIPQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one?
The IUPAC name of 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one (CID 164982464) is 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one.
What is the SMILES notation for 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one?
The canonical SMILES for 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one is CC(C)CC(=O)CN(C)C(F)(F)C(C)C.
What is the InChIKey of 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one?
The InChIKey is ZHECKBDNATWIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F2NO/c1-8(2)6-10(15)7-14(5)11(12,13)9(3)4/h8-9H,6-7H2,1-5H3.
What are the key properties of 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one?
1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one has a molecular weight of 221.29 g/mol, XLogP of 2.78, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1,1-difluoro-2-methylpropyl)-methylamino]-4-methylpentan-2-one is sourced from PubChem (CID 164982464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).