C20H23FN6O2 — CID 164983869
4-ethyl-6-fluoro-11-methyl-18-(methylamino)-9-oxa-2,12,16,20,21-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14,16,18-heptaen-13-one (PubChem CID 164983869) has the molecular formula C20H23FN6O2 and a molecular weight of 398.44 g/mol. Its IUPAC name is 4-ethyl-6-fluoro-11-methyl-18-(methylamino)-9-oxa-2,12,16,20,21-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14,16,18-heptaen-13-one.
| Compound Name | 4-ethyl-6-fluoro-11-methyl-18-(methylamino)-9-oxa-2,12,16,20,21-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14,16,18-heptaen-13-one |
|---|---|
| PubChem CID | 164983869 |
| Molecular Formula | C20H23FN6O2 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-ethyl-6-fluoro-11-methyl-18-(methylamino)-9-oxa-2,12,16,20,21-pentazatetracyclo[12.5.2.13,7.017,21]docosa-1(20),3,5,7(22),14,16,18-heptaen-13-one |
| SMILES | CCc1cc(F)c2cc1Nc1cc(NC)c3ncc(n3n1)C(=O)NC(C)COC2 |
| InChI | InChI=1S/C20H23FN6O2/c1-4-12-5-14(21)13-6-15(12)25-18-7-16(22-3)19-23-8-17(27(19)26-18)20(28)24-11(2)9-29-10-13/h5-8,11,22H,4,9-10H2,1-3H3,(H,24,28)(H,25,26) |
| InChIKey | KZLCHVCBBNHBPD-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|