About 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one
4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one (PubChem CID 164984054) has the molecular formula C15H16INO5
and a molecular weight of 418.21 g/mol. Its IUPAC name is 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one.
Molecular Properties
| Compound Name | 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one |
| PubChem CID | 164984054 |
| Molecular Formula | C15H16INO5 |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one |
| SMILES | Nc1ccc(O)cc1O.O=C1Cc2ccc(O)cc2O1.[2H]CI |
| InChI | InChI=1S/C8H6O3.C6H7NO2.CH3I/c9-6-2-1-5-3-8(10)11-7(5)4-6;7-5-2-1-4(8)3-6(5)9;1-2/h1-2,4,9H,3H2;1-3,8-9H,7H2;1H3/i;;1D |
| InChIKey | FXBDPENDTCRDGH-PRQZKWGPSA-N |
| XLogP | 2.58 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one?
The IUPAC name of 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one (CID 164984054) is 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one.
What is the SMILES notation for 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one?
The canonical SMILES for 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one is Nc1ccc(O)cc1O.O=C1Cc2ccc(O)cc2O1.[2H]CI.
What is the InChIKey of 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one?
The InChIKey is FXBDPENDTCRDGH-PRQZKWGPSA-N. The full InChI is InChI=1S/C8H6O3.C6H7NO2.CH3I/c9-6-2-1-5-3-8(10)11-7(5)4-6;7-5-2-1-4(8)3-6(5)9;1-2/h1-2,4,9H,3H2;1-3,8-9H,7H2;1H3/i;;1D.
What are the key properties of 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one?
4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one has a molecular weight of 418.21 g/mol, XLogP of 2.58, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzene-1,3-diol;deuterio(iodo)methane;6-hydroxy-3H-1-benzofuran-2-one is sourced from PubChem (CID 164984054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).