C25H23N7O — CID 164986448
4-[1-[[6-[cyclopropyl(methoxy)methyl]-2-pyridinyl]methyl]triazol-4-yl]-6-(3-ethynylphenyl)pyrimidin-2-amine (PubChem CID 164986448) has the molecular formula C25H23N7O and a molecular weight of 437.51 g/mol. Its IUPAC name is 4-[1-[[6-[cyclopropyl(methoxy)methyl]-2-pyridinyl]methyl]triazol-4-yl]-6-(3-ethynylphenyl)pyrimidin-2-amine.
| Compound Name | 4-[1-[[6-[cyclopropyl(methoxy)methyl]-2-pyridinyl]methyl]triazol-4-yl]-6-(3-ethynylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 164986448 |
| Molecular Formula | C25H23N7O |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-[1-[[6-[cyclopropyl(methoxy)methyl]-2-pyridinyl]methyl]triazol-4-yl]-6-(3-ethynylphenyl)pyrimidin-2-amine |
| SMILES | C#Cc1cccc(-c2cc(-c3cn(Cc4cccc(C(OC)C5CC5)n4)nn3)nc(N)n2)c1 |
| InChI | InChI=1S/C25H23N7O/c1-3-16-6-4-7-18(12-16)21-13-22(29-25(26)28-21)23-15-32(31-30-23)14-19-8-5-9-20(27-19)24(33-2)17-10-11-17/h1,4-9,12-13,15,17,24H,10-11,14H2,2H3,(H2,26,28,29) |
| InChIKey | QWILSAUTGMWPJS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|