About 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane
2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane (PubChem CID 164987021) has the molecular formula C17H34OSi
and a molecular weight of 282.54 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane.
Molecular Properties
| Compound Name | 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane |
| PubChem CID | 164987021 |
| Molecular Formula | C17H34OSi |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane |
| SMILES | CC1C=CCC(CO[Si](C)(C)C(C)(C)C(C)C)C1C |
| InChI | InChI=1S/C17H34OSi/c1-13(2)17(5,6)19(7,8)18-12-16-11-9-10-14(3)15(16)4/h9-10,13-16H,11-12H2,1-8H3 |
| InChIKey | QQACEJJQYZYEIH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane?
The IUPAC name of 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane (CID 164987021) is 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane.
What is the SMILES notation for 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane?
The canonical SMILES for 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane is CC1C=CCC(CO[Si](C)(C)C(C)(C)C(C)C)C1C.
What is the InChIKey of 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane?
The InChIKey is QQACEJJQYZYEIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34OSi/c1-13(2)17(5,6)19(7,8)18-12-16-11-9-10-14(3)15(16)4/h9-10,13-16H,11-12H2,1-8H3.
What are the key properties of 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane?
2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane has a molecular weight of 282.54 g/mol, XLogP of 5.49, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutan-2-yl-[(5,6-dimethylcyclohex-3-en-1-yl)methoxy]-dimethylsilane is sourced from PubChem (CID 164987021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).