About 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide
4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide (PubChem CID 164987207) has the molecular formula C17H15N5O2S
and a molecular weight of 353.41 g/mol. Its IUPAC name is 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide |
| PubChem CID | 164987207 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc2c(ncc3cnn(Cc4ccc(S(N)(=O)=O)cc4)c32)n1 |
| InChI | InChI=1S/C17H15N5O2S/c1-11-2-7-15-16-13(8-19-17(15)21-11)9-20-22(16)10-12-3-5-14(6-4-12)25(18,23)24/h2-9H,10H2,1H3,(H2,18,23,24) |
| InChIKey | QMHWGIRJCQUKDB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide?
The IUPAC name of 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide (CID 164987207) is 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide.
What is the SMILES notation for 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide?
The canonical SMILES for 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide is Cc1ccc2c(ncc3cnn(Cc4ccc(S(N)(=O)=O)cc4)c32)n1.
What is the InChIKey of 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide?
The InChIKey is QMHWGIRJCQUKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5O2S/c1-11-2-7-15-16-13(8-19-17(15)21-11)9-20-22(16)10-12-3-5-14(6-4-12)25(18,23)24/h2-9H,10H2,1H3,(H2,18,23,24).
What are the key properties of 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide?
4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide has a molecular weight of 353.41 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-methylpyrazolo[4,3-c][1,8]naphthyridin-1-yl)methyl]benzenesulfonamide is sourced from PubChem (CID 164987207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).