C19H19F2N5O2 — CID 164987828
3-(3,3-difluorocyclobutyl)-1-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-yl]propan-1-one (PubChem CID 164987828) has the molecular formula C19H19F2N5O2 and a molecular weight of 387.39 g/mol. Its IUPAC name is 3-(3,3-difluorocyclobutyl)-1-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-yl]propan-1-one.
| Compound Name | 3-(3,3-difluorocyclobutyl)-1-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 164987828 |
| Molecular Formula | C19H19F2N5O2 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-(3,3-difluorocyclobutyl)-1-[5-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-6,7-dihydro-4H-[1,2]oxazolo[4,5-c]pyridin-3-yl]propan-1-one |
| SMILES | O=C(CCC1CC(F)(F)C1)c1noc2c1CN(c1ncnc3[nH]ccc13)CC2 |
| InChI | InChI=1S/C19H19F2N5O2/c20-19(21)7-11(8-19)1-2-14(27)16-13-9-26(6-4-15(13)28-25-16)18-12-3-5-22-17(12)23-10-24-18/h3,5,10-11H,1-2,4,6-9H2,(H,22,23,24) |
| InChIKey | GKIWHJCQHIKDCW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |