C37H27F3N4O5 — CID 164988300
5-[2-[2-[4-[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-2-methylphenyl]-1,3-dioxoisoindol-5-yl]-1,1,1-trifluoropropan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 164988300) has the molecular formula C37H27F3N4O5 and a molecular weight of 664.64 g/mol. Its IUPAC name is 5-[2-[2-[4-[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-2-methylphenyl]-1,3-dioxoisoindol-5-yl]-1,1,1-trifluoropropan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[2-[4-[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-2-methylphenyl]-1,3-dioxoisoindol-5-yl]-1,1,1-trifluoropropan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 164988300 |
| Molecular Formula | C37H27F3N4O5 |
| Molecular Weight | 664.64 g/mol |
| Exact Mass | 664.19 |
| IUPAC Name | 5-[2-[2-[4-[5-(3,4-dimethylphenyl)-1,3,4-oxadiazol-2-yl]-2-methylphenyl]-1,3-dioxoisoindol-5-yl]-1,1,1-trifluoropropan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(N4C(=O)c5ccc(C(C)(c6ccc7c(c6)C(=O)N(C)C7=O)C(F)(F)F)cc5C4=O)c(C)c3)o2)cc1C |
| InChI | InChI=1S/C37H27F3N4O5/c1-18-6-7-21(14-19(18)2)30-41-42-31(49-30)22-8-13-29(20(3)15-22)44-34(47)26-12-10-24(17-28(26)35(44)48)36(4,37(38,39)40)23-9-11-25-27(16-23)33(46)43(5)32(25)45/h6-17H,1-5H3 |
| InChIKey | XCZLLFCTSONCTP-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.64 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|