C37H24F6N4O5 — CID 164988302
2-methyl-5-[1,1,1-trifluoro-2-[2-[2-methyl-4-[5-[4-methyl-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione (PubChem CID 164988302) has the molecular formula C37H24F6N4O5 and a molecular weight of 718.61 g/mol. Its IUPAC name is 2-methyl-5-[1,1,1-trifluoro-2-[2-[2-methyl-4-[5-[4-methyl-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[1,1,1-trifluoro-2-[2-[2-methyl-4-[5-[4-methyl-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164988302 |
| Molecular Formula | C37H24F6N4O5 |
| Molecular Weight | 718.61 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | 2-methyl-5-[1,1,1-trifluoro-2-[2-[2-methyl-4-[5-[4-methyl-3-(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]-1,3-dioxoisoindol-5-yl]propan-2-yl]isoindole-1,3-dione |
| SMILES | Cc1cc(-c2nnc(-c3ccc(C)c(C(F)(F)F)c3)o2)ccc1N1C(=O)c2ccc(C(C)(c3ccc4c(c3)C(=O)N(C)C4=O)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C37H24F6N4O5/c1-17-5-6-20(14-27(17)36(38,39)40)30-45-44-29(52-30)19-7-12-28(18(2)13-19)47-33(50)24-11-9-22(16-26(24)34(47)51)35(3,37(41,42)43)21-8-10-23-25(15-21)32(49)46(4)31(23)48/h5-16H,1-4H3 |
| InChIKey | QUKVQNVZIQPHCK-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 113.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.61 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|