C34H35FN6O4S — CID 164989369
ethyl (2S,3S)-3-[[6-cyclopropyl-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate (PubChem CID 164989369) has the molecular formula C34H35FN6O4S and a molecular weight of 642.76 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[[6-cyclopropyl-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[[6-cyclopropyl-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 164989369 |
| Molecular Formula | C34H35FN6O4S |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | ethyl (2S,3S)-3-[[6-cyclopropyl-2-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]amino]bicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1C2CCC(CC2)[C@@H]1Nc1nc(-c2cn(S(=O)(=O)c3ccc(C)cc3)c3ncc(F)cc23)nn2cc(C3CC3)cc12 |
| InChI | InChI=1S/C34H35FN6O4S/c1-3-45-34(42)29-21-8-10-22(11-9-21)30(29)37-32-28-14-23(20-6-7-20)17-40(28)39-31(38-32)27-18-41(33-26(27)15-24(35)16-36-33)46(43,44)25-12-4-19(2)5-13-25/h4-5,12-18,20-22,29-30H,3,6-11H2,1-2H3,(H,37,38,39)/t21?,22?,29-,30-/m0/s1 |
| InChIKey | GQEZNIJOSPXYDF-GGQYXWCNSA-N |
| XLogP | 6.09 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |