C28H43F2N3O10P2 — CID 164989634
[4-(9-amino-1-fluoro-2-oxononyl)phenyl] dihydrogen phosphate;[4-(6-aminohexanoylamino)-2-(fluoromethyl)phenyl] dihydrogen phosphate (PubChem CID 164989634) has the molecular formula C28H43F2N3O10P2 and a molecular weight of 681.61 g/mol. Its IUPAC name is [4-(9-amino-1-fluoro-2-oxononyl)phenyl] dihydrogen phosphate;[4-(6-aminohexanoylamino)-2-(fluoromethyl)phenyl] dihydrogen phosphate.
| Compound Name | [4-(9-amino-1-fluoro-2-oxononyl)phenyl] dihydrogen phosphate;[4-(6-aminohexanoylamino)-2-(fluoromethyl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 164989634 |
| Molecular Formula | C28H43F2N3O10P2 |
| Molecular Weight | 681.61 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | [4-(9-amino-1-fluoro-2-oxononyl)phenyl] dihydrogen phosphate;[4-(6-aminohexanoylamino)-2-(fluoromethyl)phenyl] dihydrogen phosphate |
| SMILES | NCCCCCC(=O)Nc1ccc(OP(=O)(O)O)c(CF)c1.NCCCCCCCC(=O)C(F)c1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C15H23FNO5P.C13H20FN2O5P/c16-15(14(18)6-4-2-1-3-5-11-17)12-7-9-13(10-8-12)22-23(19,20)21;14-9-10-8-11(5-6-12(10)21-22(18,19)20)16-13(17)4-2-1-3-7-15/h7-10,15H,1-6,11,17H2,(H2,19,20,21);5-6,8H,1-4,7,9,15H2,(H,16,17)(H2,18,19,20) |
| InChIKey | GRBBPAGXCKGOIM-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 231.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|