C33H53F2N9O2 — CID 164990604
23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-17,20-difluoro-3-propan-2-yl-1,4,8,9,10,24,27-heptazahexacyclo[17.6.2.18,11.02,7.013,18.022,26]octacos-11(28)-en-25-one (PubChem CID 164990604) has the molecular formula C33H53F2N9O2 and a molecular weight of 645.84 g/mol. Its IUPAC name is 23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-17,20-difluoro-3-propan-2-yl-1,4,8,9,10,24,27-heptazahexacyclo[17.6.2.18,11.02,7.013,18.022,26]octacos-11(28)-en-25-one.
| Compound Name | 23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-17,20-difluoro-3-propan-2-yl-1,4,8,9,10,24,27-heptazahexacyclo[17.6.2.18,11.02,7.013,18.022,26]octacos-11(28)-en-25-one |
|---|---|
| PubChem CID | 164990604 |
| Molecular Formula | C33H53F2N9O2 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.43 |
| IUPAC Name | 23-[(2S,5R)-2,5-dimethyl-4-prop-2-enoylpiperazin-1-yl]-17,20-difluoro-3-propan-2-yl-1,4,8,9,10,24,27-heptazahexacyclo[17.6.2.18,11.02,7.013,18.022,26]octacos-11(28)-en-25-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2CC2=CN(NN2)C2CCNC(C(C)C)C23)C[C@H]1C |
| InChI | InChI=1S/C33H53F2N9O2/c1-6-26(45)41-14-19(5)42(15-18(41)4)31-22-13-24(35)29-27-20(8-7-9-23(27)34)12-21-16-43(40-39-21)25-10-11-36-28(17(2)3)30(25)44(32(22)37-29)33(46)38-31/h6,16-20,22-25,27-32,36-37,39-40H,1,7-15H2,2-5H3,(H,38,46)/t18-,19+,20?,22?,23?,24?,25?,27?,28?,29?,30?,31?,32?/m1/s1 |
| InChIKey | SOOHITBXPFMZFW-MYRJZBIZSA-N |
| XLogP | 2.17 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|