C13H13N5O2 — CID 164992076
5,11-dimethyl-4,8-dioxa-3,11,13,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2,5,12,14,16-hexaen-16-amine (PubChem CID 164992076) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 5,11-dimethyl-4,8-dioxa-3,11,13,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2,5,12,14,16-hexaen-16-amine.
| Compound Name | 5,11-dimethyl-4,8-dioxa-3,11,13,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2,5,12,14,16-hexaen-16-amine |
|---|---|
| PubChem CID | 164992076 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 5,11-dimethyl-4,8-dioxa-3,11,13,15-tetrazatetracyclo[8.7.0.02,6.012,17]heptadeca-1(10),2,5,12,14,16-hexaen-16-amine |
| SMILES | Cc1onc2c1COCc1c-2c2c(N)ncnc2n1C |
| InChI | InChI=1S/C13H13N5O2/c1-6-7-3-19-4-8-9(11(7)17-20-6)10-12(14)15-5-16-13(10)18(8)2/h5H,3-4H2,1-2H3,(H2,14,15,16) |
| InChIKey | SPFVTMQRMKZTAF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |